C25H26FN3O4S — CID 55800492
1-benzylsulfonyl-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]piperidine-4-carboxamide (PubChem CID 55800492) has the molecular formula C25H26FN3O4S and a molecular weight of 483.57 g/mol. Its IUPAC name is 1-benzylsulfonyl-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-benzylsulfonyl-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55800492 |
| Molecular Formula | C25H26FN3O4S |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 1-benzylsulfonyl-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(Oc2ccc(F)cc2)nc1)C1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H26FN3O4S/c26-22-7-9-23(10-8-22)33-24-11-6-20(16-27-24)17-28-25(30)21-12-14-29(15-13-21)34(31,32)18-19-4-2-1-3-5-19/h1-11,16,21H,12-15,17-18H2,(H,28,30) |
| InChIKey | NOGZXBZNSFATIO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |