C25H31FN2O3S — CID 55781036
1-benzylsulfonyl-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]piperidine-4-carboxamide (PubChem CID 55781036) has the molecular formula C25H31FN2O3S and a molecular weight of 458.60 g/mol. Its IUPAC name is 1-benzylsulfonyl-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-benzylsulfonyl-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55781036 |
| Molecular Formula | C25H31FN2O3S |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 1-benzylsulfonyl-N-[[1-(4-fluorophenyl)cyclopentyl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCC1(c2ccc(F)cc2)CCCC1)C1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H31FN2O3S/c26-23-10-8-22(9-11-23)25(14-4-5-15-25)19-27-24(29)21-12-16-28(17-13-21)32(30,31)18-20-6-2-1-3-7-20/h1-3,6-11,21H,4-5,12-19H2,(H,27,29) |
| InChIKey | FJEBIPCSCYMTNV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |