C22H28FN5O3 — CID 111051370
tert-butyl 4-[N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111051370) has the molecular formula C22H28FN5O3 and a molecular weight of 429.50 g/mol. Its IUPAC name is tert-butyl 4-[N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111051370 |
| Molecular Formula | C22H28FN5O3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | tert-butyl 4-[N'-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/Cc2ccc(Oc3ccc(F)cc3)nc2)CC1 |
| InChI | InChI=1S/C22H28FN5O3/c1-22(2,3)31-21(29)28-12-10-27(11-13-28)20(24)26-15-16-4-9-19(25-14-16)30-18-7-5-17(23)6-8-18/h4-9,14H,10-13,15H2,1-3H3,(H2,24,26) |
| InChIKey | OYLMKVZNTVGVIX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|