C22H27FN4O3 — CID 55714103
4-(cyclohexylcarbamoylamino)-N-[6-(4-fluorophenoxy)-3-pyridinyl]butanamide (PubChem CID 55714103) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-(cyclohexylcarbamoylamino)-N-[6-(4-fluorophenoxy)-3-pyridinyl]butanamide.
| Compound Name | 4-(cyclohexylcarbamoylamino)-N-[6-(4-fluorophenoxy)-3-pyridinyl]butanamide |
|---|---|
| PubChem CID | 55714103 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 4-(cyclohexylcarbamoylamino)-N-[6-(4-fluorophenoxy)-3-pyridinyl]butanamide |
| SMILES | O=C(CCCNC(=O)NC1CCCCC1)Nc1ccc(Oc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C22H27FN4O3/c23-16-8-11-19(12-9-16)30-21-13-10-18(15-25-21)26-20(28)7-4-14-24-22(29)27-17-5-2-1-3-6-17/h8-13,15,17H,1-7,14H2,(H,26,28)(H2,24,27,29) |
| InChIKey | SVQTTZHAWLWFBB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|