C15H25FN2O7S — CID 168713093
(2S)-6-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 168713093) has the molecular formula C15H25FN2O7S and a molecular weight of 396.44 g/mol. Its IUPAC name is (2S)-6-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-6-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 168713093 |
| Molecular Formula | C15H25FN2O7S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (2S)-6-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCN1CC(S(=O)(=O)F)CC1=O)C(=O)O |
| InChI | InChI=1S/C15H25FN2O7S/c1-15(2,3)25-14(22)17-11(13(20)21)6-4-5-7-18-9-10(8-12(18)19)26(16,23)24/h10-11H,4-9H2,1-3H3,(H,17,22)(H,20,21)/t10?,11-/m0/s1 |
| InChIKey | WHQONNOGYVJLPB-DTIOYNMSSA-N |
| XLogP | 1.03 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|