C15H23N3O6 — CID 15871181
(2S)-6-(2-methyl-4,5-dioxoimidazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 15871181) has the molecular formula C15H23N3O6 and a molecular weight of 341.36 g/mol. Its IUPAC name is (2S)-6-(2-methyl-4,5-dioxoimidazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-6-(2-methyl-4,5-dioxoimidazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 15871181 |
| Molecular Formula | C15H23N3O6 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (2S)-6-(2-methyl-4,5-dioxoimidazol-1-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC1=NC(=O)C(=O)N1CCCC[C@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H23N3O6/c1-9-16-11(19)12(20)18(9)8-6-5-7-10(13(21)22)17-14(23)24-15(2,3)4/h10H,5-8H2,1-4H3,(H,17,23)(H,21,22)/t10-/m0/s1 |
| InChIKey | IXDHIJNVBAMCMW-JTQLQIEISA-N |
| XLogP | 0.92 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|