C14H23N3O6 — CID 85448839
6-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 85448839) has the molecular formula C14H23N3O6 and a molecular weight of 329.35 g/mol. Its IUPAC name is 6-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 6-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 85448839 |
| Molecular Formula | C14H23N3O6 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 6-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | Cc1noc(=O)n1CCCCC(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H23N3O6/c1-9-16-23-13(21)17(9)8-6-5-7-10(11(18)19)15-12(20)22-14(2,3)4/h10H,5-8H2,1-4H3,(H,15,20)(H,18,19) |
| InChIKey | GXPBVDOGKUUVRV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|