C16H30N2O4S — CID 156873103
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-thiomorpholin-4-ylheptanoic acid (PubChem CID 156873103) has the molecular formula C16H30N2O4S and a molecular weight of 346.49 g/mol. Its IUPAC name is (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-thiomorpholin-4-ylheptanoic acid.
| Compound Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-thiomorpholin-4-ylheptanoic acid |
|---|---|
| PubChem CID | 156873103 |
| Molecular Formula | C16H30N2O4S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-7-thiomorpholin-4-ylheptanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCCN1CCSCC1)C(=O)O |
| InChI | InChI=1S/C16H30N2O4S/c1-16(2,3)22-15(21)17-13(14(19)20)7-5-4-6-8-18-9-11-23-12-10-18/h13H,4-12H2,1-3H3,(H,17,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | HBNIQFCHIMRFTB-ZDUSSCGKSA-N |
| XLogP | 2.57 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|