C10H15N3O3S — CID 168718283
5-oxo-1-(2-pyrrol-1-ylethyl)pyrrolidine-3-sulfonamide (PubChem CID 168718283) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 5-oxo-1-(2-pyrrol-1-ylethyl)pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-(2-pyrrol-1-ylethyl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718283 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 5-oxo-1-(2-pyrrol-1-ylethyl)pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(CCn2cccc2)C1 |
| InChI | InChI=1S/C10H15N3O3S/c11-17(15,16)9-7-10(14)13(8-9)6-5-12-3-1-2-4-12/h1-4,9H,5-8H2,(H2,11,15,16) |
| InChIKey | WNMFMOSPXFWLPF-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |