C14H19N3O3S — CID 168718162
1-[2-(2,3-dihydroindol-1-yl)ethyl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168718162) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)ethyl]-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)ethyl]-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718162 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)ethyl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(CCN2CCc3ccccc32)C1 |
| InChI | InChI=1S/C14H19N3O3S/c15-21(19,20)12-9-14(18)17(10-12)8-7-16-6-5-11-3-1-2-4-13(11)16/h1-4,12H,5-10H2,(H2,15,19,20) |
| InChIKey | NFBLWWCYTPNXRL-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |