C10H21N3O5S — CID 168718184
1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168718184) has the molecular formula C10H21N3O5S and a molecular weight of 295.36 g/mol. Its IUPAC name is 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718184 |
| Molecular Formula | C10H21N3O5S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NCCOCCOCCN1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C10H21N3O5S/c11-1-3-17-5-6-18-4-2-13-8-9(7-10(13)14)19(12,15)16/h9H,1-8,11H2,(H2,12,15,16) |
| InChIKey | UAHHPTURGSGTGH-UHFFFAOYSA-N |
| XLogP | -2.13 |
| TPSA | 124.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|