C7H10N2O3S — CID 168716757
5-oxo-1-prop-2-ynylpyrrolidine-3-sulfonamide (PubChem CID 168716757) has the molecular formula C7H10N2O3S and a molecular weight of 202.23 g/mol. Its IUPAC name is 5-oxo-1-prop-2-ynylpyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-prop-2-ynylpyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168716757 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 5-oxo-1-prop-2-ynylpyrrolidine-3-sulfonamide |
| SMILES | C#CCN1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C7H10N2O3S/c1-2-3-9-5-6(4-7(9)10)13(8,11)12/h1,6H,3-5H2,(H2,8,11,12) |
| InChIKey | JXFMGFQVKUJMNI-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|