C9H12N4O3S — CID 168718437
5-oxo-1-(pyrazin-2-ylmethyl)pyrrolidine-3-sulfonamide (PubChem CID 168718437) has the molecular formula C9H12N4O3S and a molecular weight of 256.29 g/mol. Its IUPAC name is 5-oxo-1-(pyrazin-2-ylmethyl)pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-(pyrazin-2-ylmethyl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718437 |
| Molecular Formula | C9H12N4O3S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 5-oxo-1-(pyrazin-2-ylmethyl)pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(Cc2cnccn2)C1 |
| InChI | InChI=1S/C9H12N4O3S/c10-17(15,16)8-3-9(14)13(6-8)5-7-4-11-1-2-12-7/h1-2,4,8H,3,5-6H2,(H2,10,15,16) |
| InChIKey | DPLJLFGQRSWVPV-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |