C14H15N3O3S — CID 168718375
5-oxo-1-(quinolin-3-ylmethyl)pyrrolidine-3-sulfonamide (PubChem CID 168718375) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 5-oxo-1-(quinolin-3-ylmethyl)pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-(quinolin-3-ylmethyl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718375 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 5-oxo-1-(quinolin-3-ylmethyl)pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(Cc2cnc3ccccc3c2)C1 |
| InChI | InChI=1S/C14H15N3O3S/c15-21(19,20)12-6-14(18)17(9-12)8-10-5-11-3-1-2-4-13(11)16-7-10/h1-5,7,12H,6,8-9H2,(H2,15,19,20) |
| InChIKey | ZJLMJCVMWPHQEH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |