C13H14N2O4S — CID 168718315
1-(1-benzofuran-5-ylmethyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168718315) has the molecular formula C13H14N2O4S and a molecular weight of 294.33 g/mol. Its IUPAC name is 1-(1-benzofuran-5-ylmethyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(1-benzofuran-5-ylmethyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718315 |
| Molecular Formula | C13H14N2O4S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 1-(1-benzofuran-5-ylmethyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(Cc2ccc3occc3c2)C1 |
| InChI | InChI=1S/C13H14N2O4S/c14-20(17,18)11-6-13(16)15(8-11)7-9-1-2-12-10(5-9)3-4-19-12/h1-5,11H,6-8H2,(H2,14,17,18) |
| InChIKey | UUKZOOMZXJWPND-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |