C10H12BrN3O3S — CID 168718330
1-[(6-bromo-3-pyridinyl)methyl]-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168718330) has the molecular formula C10H12BrN3O3S and a molecular weight of 334.20 g/mol. Its IUPAC name is 1-[(6-bromo-3-pyridinyl)methyl]-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-[(6-bromo-3-pyridinyl)methyl]-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718330 |
| Molecular Formula | C10H12BrN3O3S |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 1-[(6-bromo-3-pyridinyl)methyl]-5-oxopyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(Cc2ccc(Br)nc2)C1 |
| InChI | InChI=1S/C10H12BrN3O3S/c11-9-2-1-7(4-13-9)5-14-6-8(3-10(14)15)18(12,16)17/h1-2,4,8H,3,5-6H2,(H2,12,16,17) |
| InChIKey | ONEKKKFGMPFPDC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|