C11H12BrN3O2 — CID 168697385
1-[(6-bromo-3-pyridinyl)methyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 168697385) has the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is 1-[(6-bromo-3-pyridinyl)methyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-[(6-bromo-3-pyridinyl)methyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168697385 |
| Molecular Formula | C11H12BrN3O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 1-[(6-bromo-3-pyridinyl)methyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(Cc2ccc(Br)nc2)C1 |
| InChI | InChI=1S/C11H12BrN3O2/c12-9-2-1-7(4-14-9)5-15-6-8(11(13)17)3-10(15)16/h1-2,4,8H,3,5-6H2,(H2,13,17) |
| InChIKey | ROEQGIBUACCAKV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|