C11H14N4O2 — CID 168697321
5-oxo-1-(2-pyrimidin-5-ylethyl)pyrrolidine-3-carboxamide (PubChem CID 168697321) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is 5-oxo-1-(2-pyrimidin-5-ylethyl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-1-(2-pyrimidin-5-ylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 168697321 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 5-oxo-1-(2-pyrimidin-5-ylethyl)pyrrolidine-3-carboxamide |
| SMILES | NC(=O)C1CC(=O)N(CCc2cncnc2)C1 |
| InChI | InChI=1S/C11H14N4O2/c12-11(17)9-3-10(16)15(6-9)2-1-8-4-13-7-14-5-8/h4-5,7,9H,1-3,6H2,(H2,12,17) |
| InChIKey | YDEZBEVYBKBSDH-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |