C7H12N2O2 — CID 40586168
(3R)-1-ethyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 40586168) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is (3R)-1-ethyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-ethyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 40586168 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (3R)-1-ethyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCN1C[C@H](C(N)=O)CC1=O |
| InChI | InChI=1S/C7H12N2O2/c1-2-9-4-5(7(8)11)3-6(9)10/h5H,2-4H2,1H3,(H2,8,11)/t5-/m1/s1 |
| InChIKey | TWJSDJTWVVOXRT-RXMQYKEDSA-N |
| XLogP | -0.66 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |