C8H14N2O3 — CID 17389931
1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 17389931) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17389931 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COCCN1CC(C(N)=O)CC1=O |
| InChI | InChI=1S/C8H14N2O3/c1-13-3-2-10-5-6(8(9)12)4-7(10)11/h6H,2-5H2,1H3,(H2,9,12) |
| InChIKey | ICBIPBJDSPOLPR-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |