C8H12NO4- — CID 7061674
(3R)-1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7061674) has the molecular formula C8H12NO4- and a molecular weight of 186.19 g/mol. Its IUPAC name is (3R)-1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (3R)-1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7061674 |
| Molecular Formula | C8H12NO4- |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | (3R)-1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COCCN1C[C@H](C(=O)[O-])CC1=O |
| InChI | InChI=1S/C8H13NO4/c1-13-3-2-9-5-6(8(11)12)4-7(9)10/h6H,2-5H2,1H3,(H,11,12)/p-1/t6-/m1/s1 |
| InChIKey | SQFXUCKQOKOBLC-ZCFIWIBFSA-M |
| XLogP | -1.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |