C10H17N3O5 — CID 112550970
N-(2-amino-2-oxoethoxy)-1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 112550970) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 112550970 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-1-(2-methoxyethyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | COCCN1CC(C(=O)NOCC(N)=O)CC1=O |
| InChI | InChI=1S/C10H17N3O5/c1-17-3-2-13-5-7(4-9(13)15)10(16)12-18-6-8(11)14/h7H,2-6H2,1H3,(H2,11,14)(H,12,16) |
| InChIKey | LJKWFKIWYMYAKG-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|