C12H19N3O6 — CID 43357177
4-amino-2-[[1-(2-methoxyethyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-oxobutanoic acid (PubChem CID 43357177) has the molecular formula C12H19N3O6 and a molecular weight of 301.30 g/mol. Its IUPAC name is 4-amino-2-[[1-(2-methoxyethyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[1-(2-methoxyethyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43357177 |
| Molecular Formula | C12H19N3O6 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-amino-2-[[1-(2-methoxyethyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-oxobutanoic acid |
| SMILES | COCCN1CC(C(=O)NC(CC(N)=O)C(=O)O)CC1=O |
| InChI | InChI=1S/C12H19N3O6/c1-21-3-2-15-6-7(4-10(15)17)11(18)14-8(12(19)20)5-9(13)16/h7-8H,2-6H2,1H3,(H2,13,16)(H,14,18)(H,19,20) |
| InChIKey | UZHSFYDBVXBVKY-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |