C9H13N3O3S — CID 168718383
5-oxo-1-(1H-pyrrol-2-ylmethyl)pyrrolidine-3-sulfonamide (PubChem CID 168718383) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 5-oxo-1-(1H-pyrrol-2-ylmethyl)pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-(1H-pyrrol-2-ylmethyl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168718383 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 5-oxo-1-(1H-pyrrol-2-ylmethyl)pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(Cc2ccc[nH]2)C1 |
| InChI | InChI=1S/C9H13N3O3S/c10-16(14,15)8-4-9(13)12(6-8)5-7-2-1-3-11-7/h1-3,8,11H,4-6H2,(H2,10,14,15) |
| InChIKey | PQQQGCGMGXDIGM-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |