C9H15NO5 — CID 82675148
1-(2,2-dimethoxyethyl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 82675148) has the molecular formula C9H15NO5 and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2,2-dimethoxyethyl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 82675148 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | COC(CN1CC(C(=O)O)CC1=O)OC |
| InChI | InChI=1S/C9H15NO5/c1-14-8(15-2)5-10-4-6(9(12)13)3-7(10)11/h6,8H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | PZQGHHLSOHTSKB-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|