C15H25BrN2O5 — CID 168503185
(2S)-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 168503185) has the molecular formula C15H25BrN2O5 and a molecular weight of 393.28 g/mol. Its IUPAC name is (2S)-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 168503185 |
| Molecular Formula | C15H25BrN2O5 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | (2S)-2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](C(=O)O)N1CC(CBr)CC1=O |
| InChI | InChI=1S/C15H25BrN2O5/c1-15(2,3)23-14(22)17-6-4-5-11(13(20)21)18-9-10(8-16)7-12(18)19/h10-11H,4-9H2,1-3H3,(H,17,22)(H,20,21)/t10?,11-/m0/s1 |
| InChIKey | QXHAPUNLWLRLDF-DTIOYNMSSA-N |
| XLogP | 1.99 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|