C16H26N2O6S — CID 168704256
(2S)-2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 168704256) has the molecular formula C16H26N2O6S and a molecular weight of 374.46 g/mol. Its IUPAC name is (2S)-2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 168704256 |
| Molecular Formula | C16H26N2O6S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2S)-2-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC(=O)SC1CC(=O)N(C(CCCNC(=O)OC(C)(C)C)C(=O)O)C1 |
| InChI | InChI=1S/C16H26N2O6S/c1-10(19)25-11-8-13(20)18(9-11)12(14(21)22)6-5-7-17-15(23)24-16(2,3)4/h11-12H,5-9H2,1-4H3,(H,17,23)(H,21,22) |
| InChIKey | VCWNACZMYABKHT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|