C18H24N2O6 — CID 167167125
(2S)-2-(1-hydroxy-3-oxo-1H-isoindol-2-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 167167125) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is (2S)-2-(1-hydroxy-3-oxo-1H-isoindol-2-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | (2S)-2-(1-hydroxy-3-oxo-1H-isoindol-2-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 167167125 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (2S)-2-(1-hydroxy-3-oxo-1H-isoindol-2-yl)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](C(=O)O)N1C(=O)c2ccccc2C1O |
| InChI | InChI=1S/C18H24N2O6/c1-18(2,3)26-17(25)19-10-6-9-13(16(23)24)20-14(21)11-7-4-5-8-12(11)15(20)22/h4-5,7-8,13-14,21H,6,9-10H2,1-3H3,(H,19,25)(H,23,24)/t13-,14?/m0/s1 |
| InChIKey | QINSZVICCBHDPI-LSLKUGRBSA-N |
| XLogP | 1.89 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|