C26H32AsNO6 — CID 87700468
(2S)-2-[9H-fluoren-9-yl(methoxycarbonyl)arsanyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 87700468) has the molecular formula C26H32AsNO6 and a molecular weight of 529.47 g/mol. Its IUPAC name is (2S)-2-[9H-fluoren-9-yl(methoxycarbonyl)arsanyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-2-[9H-fluoren-9-yl(methoxycarbonyl)arsanyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 87700468 |
| Molecular Formula | C26H32AsNO6 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | (2S)-2-[9H-fluoren-9-yl(methoxycarbonyl)arsanyl]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | COC(=O)[As](C1c2ccccc2-c2ccccc21)[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C26H32AsNO6/c1-26(2,3)34-25(32)28-16-10-9-15-21(23(29)30)27(24(31)33-4)22-19-13-7-5-11-17(19)18-12-6-8-14-20(18)22/h5-8,11-14,21-22H,9-10,15-16H2,1-4H3,(H,28,32)(H,29,30)/t21-,27?/m0/s1 |
| InChIKey | JEKKKNKUWSGYNB-LWAJAQLZSA-N |
| XLogP | 5.33 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|