C18H29N3O8 — CID 122617021
2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2,6-dioxopiperazin-1-yl]pentanedioic acid (PubChem CID 122617021) has the molecular formula C18H29N3O8 and a molecular weight of 415.44 g/mol. Its IUPAC name is 2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2,6-dioxopiperazin-1-yl]pentanedioic acid.
| Compound Name | 2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2,6-dioxopiperazin-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 122617021 |
| Molecular Formula | C18H29N3O8 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 2-[4-[4-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-2,6-dioxopiperazin-1-yl]pentanedioic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCN1CC(=O)N(C(CCC(=O)O)C(=O)O)C(=O)C1 |
| InChI | InChI=1S/C18H29N3O8/c1-18(2,3)29-17(28)19-8-4-5-9-20-10-13(22)21(14(23)11-20)12(16(26)27)6-7-15(24)25/h12H,4-11H2,1-3H3,(H,19,28)(H,24,25)(H,26,27) |
| InChIKey | BRUQQYFCAWAQJL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|