C21H21ClN6O — CID 142745847
4-chloro-N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]benzamide (PubChem CID 142745847) has the molecular formula C21H21ClN6O and a molecular weight of 408.89 g/mol. Its IUPAC name is 4-chloro-N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]benzamide.
| Compound Name | 4-chloro-N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]benzamide |
|---|---|
| PubChem CID | 142745847 |
| Molecular Formula | C21H21ClN6O |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-chloro-N-[4-[(1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl)amino]butyl]benzamide |
| SMILES | Cc1nnc2c(NCCCCNC(=O)c3ccc(Cl)cc3)nc3ccccc3n12 |
| InChI | InChI=1S/C21H21ClN6O/c1-14-26-27-20-19(25-17-6-2-3-7-18(17)28(14)20)23-12-4-5-13-24-21(29)15-8-10-16(22)11-9-15/h2-3,6-11H,4-5,12-13H2,1H3,(H,23,25)(H,24,29) |
| InChIKey | CXTPTRKYKOAUGF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|