C24H27N7O5 — CID 147692388
N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-4-nitrobenzamide (PubChem CID 147692388) has the molecular formula C24H27N7O5 and a molecular weight of 493.52 g/mol. Its IUPAC name is N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-4-nitrobenzamide.
| Compound Name | N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 147692388 |
| Molecular Formula | C24H27N7O5 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N-[4-[[7-(2-methoxyethoxy)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]-4-nitrobenzamide |
| SMILES | COCCOc1ccc2c(c1)nc(NCCCCNC(=O)c1ccc([N+](=O)[O-])cc1)c1nnc(C)n12 |
| InChI | InChI=1S/C24H27N7O5/c1-16-28-29-23-22(27-20-15-19(36-14-13-35-2)9-10-21(20)30(16)23)25-11-3-4-12-26-24(32)17-5-7-18(8-6-17)31(33)34/h5-10,15H,3-4,11-14H2,1-2H3,(H,25,27)(H,26,32) |
| InChIKey | GRFMKZFIQOHPDR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|