C29H35N9O — CID 142746217
1-cyclohexyl-3-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]urea (PubChem CID 142746217) has the molecular formula C29H35N9O and a molecular weight of 525.66 g/mol. Its IUPAC name is 1-cyclohexyl-3-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]urea.
| Compound Name | 1-cyclohexyl-3-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]urea |
|---|---|
| PubChem CID | 142746217 |
| Molecular Formula | C29H35N9O |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 1-cyclohexyl-3-[4-[[1-methyl-7-(1-methylbenzimidazol-2-yl)-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butyl]urea |
| SMILES | Cc1nnc2c(NCCCCNC(=O)NC3CCCCC3)nc3cc(-c4nc5ccccc5n4C)ccc3n12 |
| InChI | InChI=1S/C29H35N9O/c1-19-35-36-28-26(30-16-8-9-17-31-29(39)32-21-10-4-3-5-11-21)33-23-18-20(14-15-25(23)38(19)28)27-34-22-12-6-7-13-24(22)37(27)2/h6-7,12-15,18,21H,3-5,8-11,16-17H2,1-2H3,(H,30,33)(H2,31,32,39) |
| InChIKey | AICPTTZTVPJHPX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 114.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|