C21H30N6O3S — CID 160936505
N-[1-methyl-4-[(8-methyl-6-oxononyl)amino]-[1,2,4]triazolo[4,3-a]quinoxalin-7-yl]methanesulfonamide (PubChem CID 160936505) has the molecular formula C21H30N6O3S and a molecular weight of 446.58 g/mol. Its IUPAC name is N-[1-methyl-4-[(8-methyl-6-oxononyl)amino]-[1,2,4]triazolo[4,3-a]quinoxalin-7-yl]methanesulfonamide.
| Compound Name | N-[1-methyl-4-[(8-methyl-6-oxononyl)amino]-[1,2,4]triazolo[4,3-a]quinoxalin-7-yl]methanesulfonamide |
|---|---|
| PubChem CID | 160936505 |
| Molecular Formula | C21H30N6O3S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[1-methyl-4-[(8-methyl-6-oxononyl)amino]-[1,2,4]triazolo[4,3-a]quinoxalin-7-yl]methanesulfonamide |
| SMILES | Cc1nnc2c(NCCCCCC(=O)CC(C)C)nc3cc(NS(C)(=O)=O)ccc3n12 |
| InChI | InChI=1S/C21H30N6O3S/c1-14(2)12-17(28)8-6-5-7-11-22-20-21-25-24-15(3)27(21)19-10-9-16(13-18(19)23-20)26-31(4,29)30/h9-10,13-14,26H,5-8,11-12H2,1-4H3,(H,22,23) |
| InChIKey | STYGYWNRIBHIIT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 118.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|