C21H36N6O2 — CID 142406546
tert-butyl N-[4-[[3-imino-4-(2-methylpropanimidoyl)quinoxalin-2-yl]amino]butyl]carbamate;molecular hydrogen (PubChem CID 142406546) has the molecular formula C21H36N6O2 and a molecular weight of 404.56 g/mol. Its IUPAC name is tert-butyl N-[4-[[3-imino-4-(2-methylpropanimidoyl)quinoxalin-2-yl]amino]butyl]carbamate;molecular hydrogen.
| Compound Name | tert-butyl N-[4-[[3-imino-4-(2-methylpropanimidoyl)quinoxalin-2-yl]amino]butyl]carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 142406546 |
| Molecular Formula | C21H36N6O2 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | tert-butyl N-[4-[[3-imino-4-(2-methylpropanimidoyl)quinoxalin-2-yl]amino]butyl]carbamate;molecular hydrogen |
| SMILES | [H]/N=C(\C(C)C)n1/c(=N/[H])c(NCCCCNC(=O)OC(C)(C)C)nc2ccccc21.[H][H].[H][H] |
| InChI | InChI=1S/C21H32N6O2.2H2/c1-14(2)17(22)27-16-11-7-6-10-15(16)26-19(18(27)23)24-12-8-9-13-25-20(28)29-21(3,4)5;;/h6-7,10-11,14,22-23H,8-9,12-13H2,1-5H3,(H,24,26)(H,25,28);2*1H/b22-17+,23-18+;; |
| InChIKey | BHWYARQOKFIXJC-XJAABRCYSA-N |
| XLogP | 4.21 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|