C15H18N2O4 — CID 129052197
tert-butyl 2-(2-methoxy-2-oxoethyl)benzimidazole-1-carboxylate (PubChem CID 129052197) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is tert-butyl 2-(2-methoxy-2-oxoethyl)benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-(2-methoxy-2-oxoethyl)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 129052197 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | tert-butyl 2-(2-methoxy-2-oxoethyl)benzimidazole-1-carboxylate |
| SMILES | COC(=O)Cc1nc2ccccc2n1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H18N2O4/c1-15(2,3)21-14(19)17-11-8-6-5-7-10(11)16-12(17)9-13(18)20-4/h5-8H,9H2,1-4H3 |
| InChIKey | MBTLUTCQFSOHER-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |