About 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate
2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate (PubChem CID 67187186) has the molecular formula C14H18N2O2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate |
| PubChem CID | 67187186 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate |
| SMILES | CCC(C)(C)OC(=O)n1c(C)nc2ccccc21 |
| InChI | InChI=1S/C14H18N2O2/c1-5-14(3,4)18-13(17)16-10(2)15-11-8-6-7-9-12(11)16/h6-9H,5H2,1-4H3 |
| InChIKey | NAVKRLFJNXPSFN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate?
The IUPAC name of 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate (CID 67187186) is 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate.
What is the SMILES notation for 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate?
The canonical SMILES for 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate is CCC(C)(C)OC(=O)n1c(C)nc2ccccc21.
What is the InChIKey of 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate?
The InChIKey is NAVKRLFJNXPSFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2/c1-5-14(3,4)18-13(17)16-10(2)15-11-8-6-7-9-12(11)16/h6-9H,5H2,1-4H3.
What are the key properties of 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate?
2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate has a molecular weight of 246.31 g/mol, XLogP of 3.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-yl 2-methylbenzimidazole-1-carboxylate is sourced from PubChem (CID 67187186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).