C12H13N3O4 — CID 640772
ethyl 2-(methoxycarbonylamino)benzimidazole-1-carboxylate (PubChem CID 640772) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is ethyl 2-(methoxycarbonylamino)benzimidazole-1-carboxylate.
| Compound Name | ethyl 2-(methoxycarbonylamino)benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 640772 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | ethyl 2-(methoxycarbonylamino)benzimidazole-1-carboxylate |
| SMILES | CCOC(=O)n1c(NC(=O)OC)nc2ccccc21 |
| InChI | InChI=1S/C12H13N3O4/c1-3-19-12(17)15-9-7-5-4-6-8(9)13-10(15)14-11(16)18-2/h4-7H,3H2,1-2H3,(H,13,14,16) |
| InChIKey | OABCPBLFAMAZBI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |