C21H22N4O4 — CID 54161815
(2-methoxy-4-prop-2-enylphenyl) 2-(ethoxycarbonylamino)benzimidazole-1-carboximidate (PubChem CID 54161815) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is (2-methoxy-4-prop-2-enylphenyl) 2-(ethoxycarbonylamino)benzimidazole-1-carboximidate.
| Compound Name | (2-methoxy-4-prop-2-enylphenyl) 2-(ethoxycarbonylamino)benzimidazole-1-carboximidate |
|---|---|
| PubChem CID | 54161815 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (2-methoxy-4-prop-2-enylphenyl) 2-(ethoxycarbonylamino)benzimidazole-1-carboximidate |
| SMILES | [H]/N=C(/Oc1ccc(CC=C)cc1OC)n1c(NC(=O)OCC)nc2ccccc21 |
| InChI | InChI=1S/C21H22N4O4/c1-4-8-14-11-12-17(18(13-14)27-3)29-19(22)25-16-10-7-6-9-15(16)23-20(25)24-21(26)28-5-2/h4,6-7,9-13,22H,1,5,8H2,2-3H3,(H,23,24,26)/b22-19+ |
| InChIKey | OOYLQICUQPOBEU-ZBJSNUHESA-N |
| XLogP | 4.20 |
| TPSA | 98.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|