C18H18N4O3 — CID 54558121
(3,4-dimethylphenyl) 2-(methoxycarbonylamino)benzimidazole-1-carboximidate (PubChem CID 54558121) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 2-(methoxycarbonylamino)benzimidazole-1-carboximidate.
| Compound Name | (3,4-dimethylphenyl) 2-(methoxycarbonylamino)benzimidazole-1-carboximidate |
|---|---|
| PubChem CID | 54558121 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (3,4-dimethylphenyl) 2-(methoxycarbonylamino)benzimidazole-1-carboximidate |
| SMILES | [H]/N=C(/Oc1ccc(C)c(C)c1)n1c(NC(=O)OC)nc2ccccc21 |
| InChI | InChI=1S/C18H18N4O3/c1-11-8-9-13(10-12(11)2)25-16(19)22-15-7-5-4-6-14(15)20-17(22)21-18(23)24-3/h4-10,19H,1-3H3,(H,20,21,23)/b19-16+ |
| InChIKey | ZOPJZEXJPRNPIF-KNTRCKAVSA-N |
| XLogP | 3.69 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|