C15H21N5O3 — CID 70848441
methyl N-[1-(5-aminopentylcarbamoyl)benzimidazol-2-yl]carbamate (PubChem CID 70848441) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is methyl N-[1-(5-aminopentylcarbamoyl)benzimidazol-2-yl]carbamate.
| Compound Name | methyl N-[1-(5-aminopentylcarbamoyl)benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 70848441 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | methyl N-[1-(5-aminopentylcarbamoyl)benzimidazol-2-yl]carbamate |
| SMILES | COC(=O)Nc1nc2ccccc2n1C(=O)NCCCCCN |
| InChI | InChI=1S/C15H21N5O3/c1-23-15(22)19-13-18-11-7-3-4-8-12(11)20(13)14(21)17-10-6-2-5-9-16/h3-4,7-8H,2,5-6,9-10,16H2,1H3,(H,17,21)(H,18,19,22) |
| InChIKey | AIZDKNTXHNHCPR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|