C28H34ClN7O5 — CID 67762400
1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one;methyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate (PubChem CID 67762400) has the molecular formula C28H34ClN7O5 and a molecular weight of 584.08 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one;methyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate.
| Compound Name | 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one;methyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 67762400 |
| Molecular Formula | C28H34ClN7O5 |
| Molecular Weight | 584.08 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one;methyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate |
| SMILES | CC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1cncn1.CCCCNC(=O)n1c(NC(=O)OC)nc2ccccc21 |
| InChI | InChI=1S/C14H16ClN3O2.C14H18N4O3/c1-14(2,3)12(19)13(18-9-16-8-17-18)20-11-6-4-10(15)5-7-11;1-3-4-9-15-13(19)18-11-8-6-5-7-10(11)16-12(18)17-14(20)21-2/h4-9,13H,1-3H3;5-8H,3-4,9H2,1-2H3,(H,15,19)(H,16,17,20) |
| InChIKey | XXKOYGUDZPYTTH-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 142.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.08 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|