C17H24N4O4 — CID 18948009
1-ethoxyethyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate (PubChem CID 18948009) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-ethoxyethyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate.
| Compound Name | 1-ethoxyethyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate |
|---|---|
| PubChem CID | 18948009 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-ethoxyethyl N-[1-(butylcarbamoyl)benzimidazol-2-yl]carbamate |
| SMILES | CCCCNC(=O)n1c(NC(=O)OC(C)OCC)nc2ccccc21 |
| InChI | InChI=1S/C17H24N4O4/c1-4-6-11-18-16(22)21-14-10-8-7-9-13(14)19-15(21)20-17(23)25-12(3)24-5-2/h7-10,12H,4-6,11H2,1-3H3,(H,18,22)(H,19,20,23) |
| InChIKey | BOZRJDRWAHRKAY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|