C19H28N4O5 — CID 175510810
2-[1-[(4-ethoxy-4-hydroxybutyl)carbamoylamino]-2-methylpropan-2-yl]benzimidazole-1-carboxylic acid (PubChem CID 175510810) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-[1-[(4-ethoxy-4-hydroxybutyl)carbamoylamino]-2-methylpropan-2-yl]benzimidazole-1-carboxylic acid.
| Compound Name | 2-[1-[(4-ethoxy-4-hydroxybutyl)carbamoylamino]-2-methylpropan-2-yl]benzimidazole-1-carboxylic acid |
|---|---|
| PubChem CID | 175510810 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 2-[1-[(4-ethoxy-4-hydroxybutyl)carbamoylamino]-2-methylpropan-2-yl]benzimidazole-1-carboxylic acid |
| SMILES | CCOC(O)CCCNC(=O)NCC(C)(C)c1nc2ccccc2n1C(=O)O |
| InChI | InChI=1S/C19H28N4O5/c1-4-28-15(24)10-7-11-20-17(25)21-12-19(2,3)16-22-13-8-5-6-9-14(13)23(16)18(26)27/h5-6,8-9,15,24H,4,7,10-12H2,1-3H3,(H,26,27)(H2,20,21,25) |
| InChIKey | TWMICDKBXCFMEW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|