C18H28N4O2 — CID 111120857
1-[3-(benzimidazol-1-yl)propyl]-3-(2-hydroxy-2,3-dimethylpentyl)urea (PubChem CID 111120857) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[3-(benzimidazol-1-yl)propyl]-3-(2-hydroxy-2,3-dimethylpentyl)urea.
| Compound Name | 1-[3-(benzimidazol-1-yl)propyl]-3-(2-hydroxy-2,3-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111120857 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 1-[3-(benzimidazol-1-yl)propyl]-3-(2-hydroxy-2,3-dimethylpentyl)urea |
| SMILES | CCC(C)C(C)(O)CNC(=O)NCCCn1cnc2ccccc21 |
| InChI | InChI=1S/C18H28N4O2/c1-4-14(2)18(3,24)12-20-17(23)19-10-7-11-22-13-21-15-8-5-6-9-16(15)22/h5-6,8-9,13-14,24H,4,7,10-12H2,1-3H3,(H2,19,20,23) |
| InChIKey | YABUSTNGAGMSRG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|