C11H21F3N2O2 — CID 111509227
1-(2-hydroxy-2,3-dimethylpentyl)-3-(3,3,3-trifluoropropyl)urea (PubChem CID 111509227) has the molecular formula C11H21F3N2O2 and a molecular weight of 270.30 g/mol. Its IUPAC name is 1-(2-hydroxy-2,3-dimethylpentyl)-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-(2-hydroxy-2,3-dimethylpentyl)-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 111509227 |
| Molecular Formula | C11H21F3N2O2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 1-(2-hydroxy-2,3-dimethylpentyl)-3-(3,3,3-trifluoropropyl)urea |
| SMILES | CCC(C)C(C)(O)CNC(=O)NCCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O2/c1-4-8(2)10(3,18)7-16-9(17)15-6-5-11(12,13)14/h8,18H,4-7H2,1-3H3,(H2,15,16,17) |
| InChIKey | YJKJUWIBWSJASA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |