C13H28N2O2 — CID 111120801
1-(2-hydroxy-2,3-dimethylpentyl)-3-pentan-3-ylurea (PubChem CID 111120801) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(2-hydroxy-2,3-dimethylpentyl)-3-pentan-3-ylurea.
| Compound Name | 1-(2-hydroxy-2,3-dimethylpentyl)-3-pentan-3-ylurea |
|---|---|
| PubChem CID | 111120801 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-(2-hydroxy-2,3-dimethylpentyl)-3-pentan-3-ylurea |
| SMILES | CCC(CC)NC(=O)NCC(C)(O)C(C)CC |
| InChI | InChI=1S/C13H28N2O2/c1-6-10(4)13(5,17)9-14-12(16)15-11(7-2)8-3/h10-11,17H,6-9H2,1-5H3,(H2,14,15,16) |
| InChIKey | RMCHIVBDCGRFPX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |