C13H28N2O2 — CID 111933174
1-(1-hydroxybutan-2-yl)-3-(2,2,4-trimethylpentyl)urea (PubChem CID 111933174) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(1-hydroxybutan-2-yl)-3-(2,2,4-trimethylpentyl)urea.
| Compound Name | 1-(1-hydroxybutan-2-yl)-3-(2,2,4-trimethylpentyl)urea |
|---|---|
| PubChem CID | 111933174 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-(1-hydroxybutan-2-yl)-3-(2,2,4-trimethylpentyl)urea |
| SMILES | CCC(CO)NC(=O)NCC(C)(C)CC(C)C |
| InChI | InChI=1S/C13H28N2O2/c1-6-11(8-16)15-12(17)14-9-13(4,5)7-10(2)3/h10-11,16H,6-9H2,1-5H3,(H2,14,15,17) |
| InChIKey | LYXLZIMHMJRFBR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |