C8H18N2O2 — CID 104981803
1-[(2S)-1-hydroxybutan-2-yl]-3-propylurea (PubChem CID 104981803) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-[(2S)-1-hydroxybutan-2-yl]-3-propylurea.
| Compound Name | 1-[(2S)-1-hydroxybutan-2-yl]-3-propylurea |
|---|---|
| PubChem CID | 104981803 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 1-[(2S)-1-hydroxybutan-2-yl]-3-propylurea |
| SMILES | CCCNC(=O)N[C@@H](CC)CO |
| InChI | InChI=1S/C8H18N2O2/c1-3-5-9-8(12)10-7(4-2)6-11/h7,11H,3-6H2,1-2H3,(H2,9,10,12)/t7-/m0/s1 |
| InChIKey | ZKZXDYYFOYBXDH-ZETCQYMHSA-N |
| XLogP | 0.47 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |