C13H28N2O2 — CID 94870934
1-[(2R)-2-ethylhexyl]-3-[(2R)-1-hydroxybutan-2-yl]urea (PubChem CID 94870934) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-[(2R)-2-ethylhexyl]-3-[(2R)-1-hydroxybutan-2-yl]urea.
| Compound Name | 1-[(2R)-2-ethylhexyl]-3-[(2R)-1-hydroxybutan-2-yl]urea |
|---|---|
| PubChem CID | 94870934 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-[(2R)-2-ethylhexyl]-3-[(2R)-1-hydroxybutan-2-yl]urea |
| SMILES | CCCC[C@@H](CC)CNC(=O)N[C@H](CC)CO |
| InChI | InChI=1S/C13H28N2O2/c1-4-7-8-11(5-2)9-14-13(17)15-12(6-3)10-16/h11-12,16H,4-10H2,1-3H3,(H2,14,15,17)/t11-,12-/m1/s1 |
| InChIKey | LUCJWJGLCCSFHO-VXGBXAGGSA-N |
| XLogP | 2.27 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |